Doxycycline - Small Molecule (ID:10556-116)
HMS LINCS ID: | 10556-116 |
Name: | Doxycycline |
Alternative Names: | Doxytetracycline; Monodox; Oracea; Vibramycin |
LINCS ID: | |
PubChem CID: | 54671203 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 444.15 |
InChi: | InChI=1S/C22H24N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-7,10,14-15,17,25-27,30,32H,1-3H3,(H2,23,31)/t7-,10+,14+,15-,17-,22-/m0/s1 |
InChi Key: | SGKRLCUYIXIAHR-AKNGSSGZSA-N |
SMILES: | C[C@@H]1[C@]2([C@@H]([C@]3([C@@H](C(C(C(N)=O)=C([C@]3(C(C2=C(C4=C1C=CC=C4O)O)=O)O)O)=O)N(C)C)[H])O)[H] |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2018-08-09 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20350 | Breast Cancer Deubiquitinating Enzyme (DUB) Inhibitor Profiling: Fixed-cell GR measures of 21 breast cell lines to 32 small molecule perturbagens. Dataset 1 of 2: Normalized growth rate inhibition values. | Microscopy/Imaging |
20351 | Breast Cancer Deubiquitinating Enzyme (DUB) Inhibitor Profiling: Fixed-cell GR measures of 21 breast cell lines to 32 small molecule perturbagens. Dataset 2 of 2: Calculated dose response metrics. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10556-116-1 | Sigma Aldrich | 065M4048V |