P22077 - Small Molecule (ID:10546-101)
HMS LINCS ID: | 10546-101 |
Name: | P22077 |
Alternative Names: | P 22077 |
LINCS ID: | |
PubChem CID: | 46931953 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 314.98 |
InChi: | InChI=1S/C12H7F2NO3S2/c1-6(16)11-5-9(15(17)18)12(20-11)19-10-3-2-7(13)4-8(10)14/h2-5H,1H3 |
InChi Key: | RMAMGGNACJHXHO-UHFFFAOYSA-N |
SMILES: | CC(=O)C1=CC(=C(S1)SC2=C(C=C(C=C2)F)F)[N+](=O)[O-] |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2018-08-09 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20350 | Breast Cancer Deubiquitinating Enzyme (DUB) Inhibitor Profiling: Fixed-cell GR measures of 21 breast cell lines to 32 small molecule perturbagens. Dataset 1 of 2: Normalized growth rate inhibition values. | Microscopy/Imaging |
20351 | Breast Cancer Deubiquitinating Enzyme (DUB) Inhibitor Profiling: Fixed-cell GR measures of 21 breast cell lines to 32 small molecule perturbagens. Dataset 2 of 2: Calculated dose response metrics. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10546-101-1 | Selleck Chemicals | 01 |