2-deoxyglucose - Small Molecule (ID:10501-999)
| HMS LINCS ID: |
10501-999
|
| Name: | 2-deoxyglucose |
| Alternative Names: | 2-deoxy-D-glucose; 2-Desoxy-D-glucose; 2-DG |
| LINCS ID: | |
| PubChem CID: | 9062 |
| ChEBI ID: | |
| ChEMBL ID: | |
| Molecular Mass: | 164.07 |
| InChi: | InChI=1S/C6H12O5/c7-2-4-6(10)3(8)1-5(9)11-4/h3-10H,1-2H2/t3-,4-,5+,6+/m1/s1 |
| InChi Key: | PMMURAAUARKVCB-ZXXMMSQZSA-N |
| SMILES: | C1[C@H]([C@@H]([C@H](O[C@@H]1O)CO)O)O |
| Relevant Citations: | |
| Comments: | |
| Date Publicly Available: | |
| Most Recent Update: | 2016-05-06 |
Target Affinity:
(see Study 20000)| Target Affinity Spectrum Value | HUGO Gene Name |
|---|---|
HK1, HK2, HK3 |
Datasets:
| HMS Dataset ID | Dataset Title | HMS Dataset Type |
|---|---|---|
| 20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
| 20268 | Growth rate-corrected (GR) dose-response metrics across a panel of 71 breast cancer cell lines treated with a library of small molecule and antibody perturbagens. Dataset 1 of 4: Relative cell counts and normalized growth rate inhibition values across technical replicates. | Analysis |
| 20269 | Growth rate-corrected (GR) dose-response metrics across a panel of 71 breast cancer cell lines treated with a library of small molecule and antibody perturbagens. Dataset 2 of 4: Calculated dose-response metrics. | Analysis |
Batch Information:
| HMS LINCS Batch ID | Provider | Provider Batch ID |
|---|---|---|
| 10501-999-1 |
(equivalent to 100 nM ≤ Kd < 1µM)