Staurosporine aglycone - Small Molecule (ID:10454-101)
HMS LINCS ID: | 10454-101 |
Name: | Staurosporine aglycone |
Alternative Names: | K252C |
LINCS ID: | |
PubChem CID: | 3815 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 311.11 |
InChi: | InChI=1S/C20H13N3O/c24-20-17-12(9-21-20)15-10-5-1-3-7-13(10)22-18(15)19-16(17)11-6-2-4-8-14(11)23-19/h1-8,22-23H,9H2,(H,21,24) |
InChi Key: | MEXUTNIFSHFQRG-UHFFFAOYSA-N |
SMILES: | C1C2=C3C4=CC=CC=C4NC3=C5C(=C2C(=O)N1)C6=CC=CC=C6N5 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
JAK3, MAP3K11 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | CAMK2A, CAMK2B, CAMK2D, CAMK2G, CCND1, CDK4, MAP3K9, Prkca, PRKCA, Prkcb, PRKCB, Prkcd, PRKCD, Prkce, PRKCE, Prkcg, PRKCG, Prkch, PRKCH, PRKCI, Prkcq, PRKCQ, Prkcz, PRKCZ, PRKG1 |
3 (equivalent to 1µM ≤ Kd < 10 µM) | CCNE1, CCNE2, CDK2, GLI1, GLI2, PKD1, PRKACA, PRKD1, PRKD3 |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10454-101-1 | EMD Millipore | D00176697 |
(Kd <100 nM)