Staurosporine aglycone - Small Molecule (ID:10454-101)
| HMS LINCS ID: |
10454-101
|
| Name: | Staurosporine aglycone |
| Alternative Names: | K252C |
| LINCS ID: | |
| PubChem CID: | 3815 |
| ChEBI ID: | |
| ChEMBL ID: | |
| Molecular Mass: | 311.11 |
| InChi: | InChI=1S/C20H13N3O/c24-20-17-12(9-21-20)15-10-5-1-3-7-13(10)22-18(15)19-16(17)11-6-2-4-8-14(11)23-19/h1-8,22-23H,9H2,(H,21,24) |
| InChi Key: | MEXUTNIFSHFQRG-UHFFFAOYSA-N |
| SMILES: | C1C2=C3C4=CC=CC=C4NC3=C5C(=C2C(=O)N1)C6=CC=CC=C6N5 |
| Relevant Citations: | |
| Comments: | |
| Date Publicly Available: | |
| Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)| Target Affinity Spectrum Value | HUGO Gene Name |
|---|---|
JAK3, MAP3K11 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | CAMK2A, CAMK2B, CAMK2D, CAMK2G, CCND1, CDK4, MAP3K9, Prkca, PRKCA, Prkcb, PRKCB, Prkcd, PRKCD, Prkce, PRKCE, Prkcg, PRKCG, Prkch, PRKCH, PRKCI, Prkcq, PRKCQ, Prkcz, PRKCZ, PRKG1 |
3 (equivalent to 1µM ≤ Kd < 10 µM) | CCNE1, CCNE2, CDK2, GLI1, GLI2, PKD1, PRKACA, PRKD1, PRKD3 |
10 (confirmed non-binding) |
Batch Information for HMSL10454-101-1:
| HMS LINCS Batch ID: | 10454-101-1 |
| Provider: | EMD Millipore |
| Provider Batch ID: | D00176697 |
| Salt: | 101 |
| Molecular Formula: | C20H13N3O |
| Molecular Weight: | 311.3 |
| Purity: | |
| Purification Method: | |
| Chemical Synthesis Reference: | |
| Comments: | |
| Date Publicly Available: | 2015-08-27 |
| Most Recent Update: | 2016-08-11 |
HMS QC Testing Events for HMSL10454-101-1:
| Date | HMS QC Outcome | Comment | Files |
|---|---|---|---|
| 08/31/2015 | PASS | HMSL10454-101-1_LCMS.pdf |
(Kd <100 nM)