RO 31-8220 - Small Molecule (ID:10407-103)
| HMS LINCS ID: |
10407-103
|
| Name: | RO 31-8220 |
| Alternative Names: | Bisindolylmaleimide IX |
| LINCS ID: | |
| PubChem CID: | 5083 |
| ChEBI ID: | |
| ChEMBL ID: | |
| Molecular Mass: | 457.16 |
| InChi: | InChI=1S/C25H23N5O2S/c1-29-13-17(15-7-2-4-9-19(15)29)21-22(24(32)28-23(21)31)18-14-30(11-6-12-33-25(26)27)20-10-5-3-8-16(18)20/h2-5,7-10,13-14H,6,11-12H2,1H3,(H3,26,27)(H,28,31,32) |
| InChi Key: | DSXXEELGXBCYNQ-UHFFFAOYSA-N |
| SMILES: | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=CN(C5=CC=CC=C54)CCCSC(=N)N |
| Relevant Citations: | |
| Comments: | |
| Date Publicly Available: | |
| Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)| Target Affinity Spectrum Value | HUGO Gene Name |
|---|---|
GSK3B, PIM1, PKD1, PRKACA, Prkca, PRKCA, Prkcb, PRKCB, Prkcd, PRKCD, Prkce, PRKCE, Prkcg, PRKCG, Prkch, PRKCH, PRKCI, Prkcq, PRKCQ, Prkcz, PRKCZ, PRKD1, PRKD3, RPS6KA3, RPS6KB1 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | SIRT2 |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MAPT, SIRT1, SIRT3 |
10 (confirmed non-binding) |
Batch Information for HMSL10407-103-1:
| HMS LINCS Batch ID: | 10407-103-1 |
| Provider: | MedChem Express |
| Provider Batch ID: | 09901 |
| Salt: | 103 |
| Molecular Formula: | C26H27N5O5S2 |
| Molecular Weight: | 553.65 |
| Purity: | |
| Purification Method: | |
| Chemical Synthesis Reference: | |
| Comments: | |
| Date Publicly Available: | 2015-08-27 |
| Most Recent Update: | 2016-04-04 |
HMS QC Testing Events for HMSL10407-103-1:
| Date | HMS QC Outcome | Comment | Files |
|---|---|---|---|
| 08/31/2015 | PASS | HMSL10407-103-1_LCMS.pdf |
(Kd <100 nM)