AZD5363 - Small Molecule (ID:10370-101)
| HMS LINCS ID: |
10370-101
|
| Name: | AZD5363 |
| Alternative Names: | |
| LINCS ID: | |
| PubChem CID: | 25227436 |
| ChEBI ID: | |
| ChEMBL ID: | |
| Molecular Mass: | 428.17 |
| InChi: | InChI=1S/C21H25ClN6O2/c22-15-3-1-14(2-4-15)17(6-12-29)27-20(30)21(23)7-10-28(11-8-21)19-16-5-9-24-18(16)25-13-26-19/h1-5,9,13,17,29H,6-8,10-12,23H2,(H,27,30)(H,24,25,26)/t17-/m0/s1 |
| InChi Key: | JDUBGYFRJFOXQC-KRWDZBQOSA-N |
| SMILES: | O=C(C1(N)CCN(C2=C3C(NC=C3)=NC=N2)CC1)N[C@H](C4=CC=C(Cl)C=C4)CCO |
| Relevant Citations: | |
| Comments: | |
| Date Publicly Available: | |
| Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)| Target Affinity Spectrum Value | HUGO Gene Name |
|---|---|
AKT1, AKT2, AKT3, ROCK2 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | ROCK1 |
Datasets:
| HMS Dataset ID | Dataset Title | HMS Dataset Type |
|---|---|---|
| 20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
| 20354 | Breast Cancer Profiling Project, Drug Sensitivity phase II: Fixed-cell GR measures of 33 breast cell lines and PDX lines to 16 small molecule perturbagens from library plate II. Dataset 1 of 2: Normalized growth rate inhibition values | Microscopy/Imaging |
| 20355 | Breast Cancer Profiling Project, Drug Sensitivity phase II: Fixed-cell GR measures of 33 breast cell lines and PDX lines to 16 small molecule perturbagens from library plate II. Dataset 2 of 2: Calculated dose response metrics | Analysis |
Batch Information:
| HMS LINCS Batch ID | Provider | Provider Batch ID |
|---|---|---|
| 10370-101-1 | MedChem Express | 09523 |
(Kd <100 nM)