GNF-5837 - Small Molecule (ID:10365-101)
| HMS LINCS ID: |
10365-101
|
| Name: | GNF-5837 |
| Alternative Names: | |
| LINCS ID: | LSM-44935 |
| PubChem CID: | 59397065 |
| ChEBI ID: | |
| ChEMBL ID: | |
| Molecular Mass: | 535.16 |
| InChi: | InChI=1S/C28H21F4N5O2/c1-15-4-6-19(35-27(39)37-25-11-16(28(30,31)32)5-9-22(25)29)13-23(15)34-18-7-8-20-21(12-17-3-2-10-33-17)26(38)36-24(20)14-18/h2-14,33-34H,1H3,(H,36,38)(H2,35,37,39)/b21-12- |
| InChi Key: | YYDUWLSETXNJJT-MTJSOVHGSA-N |
| SMILES: | CC1=C(C=C(C=C1)NC(=O)NC2=C(C=CC(=C2)C(F)(F)F)F)NC3=CC4=C(C=C3)/C(=C/C5=CC=CN5)/C(=O)N4 |
| Relevant Citations: | |
| Comments: | |
| Date Publicly Available: | |
| Most Recent Update: | 2018-03-30 |
Target Affinity:
(see Study 20000)| Target Affinity Spectrum Value | HUGO Gene Name |
|---|---|
NTRK1, NTRK2 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | Kit, NTRK3, Pdgfrb |
3 (equivalent to 1µM ≤ Kd < 10 µM) | Alk, Bmx, Csf1r, Epha3, Ephb2, Fgfr3, Fgfr4, Fgr, Flt1, Flt3, Igf1r, Insr, KIT, Lyn, Mapk9, Met, Mst1r, Ret, Ros1, Src, Tie1, Zap70 |
Batch Information for HMSL10365-101-2:
| HMS LINCS Batch ID: | 10365-101-2 |
| Provider: | MedChem Express |
| Provider Batch ID: | 10556 |
| Salt: | 101 |
| Molecular Formula: | C28H21F4N5O2 |
| Molecular Weight: | 535.49 |
| Purity: | |
| Purification Method: | |
| Chemical Synthesis Reference: | |
| Comments: | |
| Date Publicly Available: | 2015-08-27 |
| Most Recent Update: | 2016-04-04 |
HMS QC Testing Events for HMSL10365-101-2:
| Date | HMS QC Outcome | Comment | Files |
|---|---|---|---|
| 08/31/2015 | PASS | HMSL10365-101-2_LCMS.pdf |
(Kd <100 nM)