GNF-5837 - Small Molecule (ID:10365-101)
HMS LINCS ID: | 10365-101 |
Name: | GNF-5837 |
Alternative Names: | |
LINCS ID: | LSM-44935 |
PubChem CID: | 59397065 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 535.16 |
InChi: | InChI=1S/C28H21F4N5O2/c1-15-4-6-19(35-27(39)37-25-11-16(28(30,31)32)5-9-22(25)29)13-23(15)34-18-7-8-20-21(12-17-3-2-10-33-17)26(38)36-24(20)14-18/h2-14,33-34H,1H3,(H,36,38)(H2,35,37,39)/b21-12- |
InChi Key: | YYDUWLSETXNJJT-MTJSOVHGSA-N |
SMILES: | CC1=C(C=C(C=C1)NC(=O)NC2=C(C=CC(=C2)C(F)(F)F)F)NC3=CC4=C(C=C3)/C(=C/C5=CC=CN5)/C(=O)N4 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2018-03-30 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
NTRK1, NTRK2 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | Kit, NTRK3, Pdgfrb |
3 (equivalent to 1µM ≤ Kd < 10 µM) | Alk, Bmx, Csf1r, Epha3, Ephb2, Fgfr3, Fgfr4, Fgr, Flt1, Flt3, Igf1r, Insr, KIT, Lyn, Mapk9, Met, Mst1r, Ret, Ros1, Src, Tie1, Zap70 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10365-101-1 | Selleck Chemicals | S751901 |
10365-101-2 | MedChem Express | 10556 |
(Kd <100 nM)