CGK733 - Small Molecule (ID:10359-101)
HMS LINCS ID: | 10359-101 |
Name: | CGK733 |
Alternative Names: | |
LINCS ID: | LSM-1610 |
PubChem CID: | 6605258 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 554.01 |
InChi: | InChI=1S/C23H18Cl3FN4O3S/c24-23(25,26)21(30-22(35)28-16-11-12-17(27)18(13-16)31(33)34)29-20(32)19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,19,21H,(H,29,32)(H2,28,30,35) |
InChi Key: | HLCDNLNLQNYZTK-UHFFFAOYSA-N |
SMILES: | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)NC(C(Cl)(Cl)Cl)NC(=S)NC3=CC(=C(C=C3)F)[N+](=O)[O-] |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
ATM, ATR | |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10359-101-1 | MedChem Express | 8865 |
(equivalent to 100 nM ≤ Kd < 1µM)