AZ 20 - Small Molecule (ID:10358-101)
HMS LINCS ID: | 10358-101 |
Name: | AZ 20 |
Alternative Names: | |
LINCS ID: | LSM-36357 |
PubChem CID: | 46244454 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 412.16 |
InChi: | InChI=1S/C21H24N4O3S/c1-14-13-28-11-10-25(14)19-12-18(21(7-8-21)29(2,26)27)23-20(24-19)16-4-3-5-17-15(16)6-9-22-17/h3-6,9,12,14,22H,7-8,10-11,13H2,1-2H3/t14-/m1/s1 |
InChi Key: | SCGCBAAYLFTIJU-CQSZACIVSA-N |
SMILES: | C[C@@H]1COCCN1C2=NC(=NC(=C2)C3(CC3)S(=O)(=O)C)C4=C5C=CNC5=CC=C4 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
ATR | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MTOR |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10358-101-1 | MedChem Express | 9282 |
(Kd <100 nM)