5z-7-oxozeaenol - Small Molecule (ID:10356-101)
| HMS LINCS ID: |
10356-101
|
| Name: | 5z-7-oxozeaenol |
| Alternative Names: | |
| LINCS ID: | LSM-43344 |
| PubChem CID: | 68810458 |
| ChEBI ID: | |
| ChEMBL ID: | |
| Molecular Mass: | 362.14 |
| InChi: | InChI=1S/C19H22O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h3-4,6-7,9-11,15,18,21-23H,5,8H2,1-2H3/b6-4+,7-3-/t11-,15-,18+/m0/s1 |
| InChi Key: | NEQZWEXWOFPKOT-BYRRXHGESA-N |
| SMILES: | C[C@H]1C/C=C\C(=O)[C@H]([C@H](C/C=C/C2=CC(=CC(=C2C(=O)O1)O)OC)O)O |
| Relevant Citations: | |
| Comments: | |
| Date Publicly Available: | |
| Most Recent Update: | 2018-03-30 |
Target Affinity:
(see Study 20000)| Target Affinity Spectrum Value | HUGO Gene Name |
|---|---|
MAP2K1, MAP3K7 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | MAP2K2, MAP2K5, MAP2K7, PDGFRB, RIOK3 |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MAP2K4, MAPK1 |
10 (confirmed non-binding) |
Datasets:
| HMS Dataset ID | Dataset Title | HMS Dataset Type |
|---|---|---|
| 20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
| 20211 | 5z-7-oxozeaenol KINOMEscan | KINOMEscan |
| 20234 | Synovial Fibroblast 3.1: Secretion response of seven primary human synovial fibroblast samples from healthy and rheumatoid arthritis donors to a panel of 3 stimuli and 5 small molecule inhibitors (replicate 1 of 2) | Bead-based immunoassay |
| 20235 | Synovial Fibroblast 3.2: Secretion response of seven primary human synovial fibroblast samples from healthy and rheumatoid arthritis-diagnosed donors to a panel of 3 stimuli and 5 small molecule inhibitors (replicate 2 of 2) | Bead-based immunoassay |
| 20255 | 5z-7-oxozeaenol KiNativ -- single dose experiment | KiNativ |
Batch Information:
| HMS LINCS Batch ID | Provider | Provider Batch ID |
|---|---|---|
| 10356-101-1 | ||
| 10356-101-2 | EMD Millipore | D00167378 |
| 10356-101-3 | Tocris |
(Kd <100 nM)