CGP74514A - Small Molecule (ID:10355-101)
HMS LINCS ID: | 10355-101 |
Name: | CGP74514A |
Alternative Names: | |
LINCS ID: | LSM-6711 |
PubChem CID: | 9908173 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 385.18 |
InChi: | InChI=1S/C19H24ClN7/c1-2-27-11-22-16-17(23-13-7-5-6-12(20)10-13)25-19(26-18(16)27)24-15-9-4-3-8-14(15)21/h5-7,10-11,14-15H,2-4,8-9,21H2,1H3,(H2,23,24,25,26)/t14-,15+/m0/s1 |
InChi Key: | UTBSBSOBZHXMHI-LSDHHAIUSA-N |
SMILES: | CCN1C=NC2=C1N=C(N=C2NC3=CC(=CC=C3)Cl)N[C@@H]4CCCC[C@@H]4N |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
CDK1 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | CDK5, CDK7, SLK, SRC |
3 (equivalent to 1µM ≤ Kd < 10 µM) | EGFR, EIF2AK2 |
10 (confirmed non-binding) |
Batch Information for HMSL10355-101-1:
HMS LINCS Batch ID: | 10355-101-1 |
Provider: | |
Provider Batch ID: | |
Salt: | 101 |
Molecular Formula: | |
Molecular Weight: | |
Purity: | |
Purification Method: | |
Chemical Synthesis Reference: | |
Comments: | |
Date Publicly Available: | 2014-03-10 |
Most Recent Update: | 2016-12-02 |
(Kd <100 nM)