GSK650394 - Small Molecule (ID:10299-101)
HMS LINCS ID: | 10299-101 |
Name: | GSK650394 |
Alternative Names: | |
LINCS ID: | LSM-6316 |
PubChem CID: | 25022668 |
ChEBI ID: | |
ChEMBL ID: | 558642 |
Molecular Mass: | 382.17 |
InChi: | InChI=1S/C25H22N2O2/c28-25(29)20-11-10-18(12-21(20)17-8-4-5-9-17)23-15-27-24-22(23)13-19(14-26-24)16-6-2-1-3-7-16/h1-3,6-7,10-15,17H,4-5,8-9H2,(H,26,27)(H,28,29) |
InChi Key: | WVSBGSNVCDAMCF-UHFFFAOYSA-N |
SMILES: | C1CCC(C1)C2=C(C=CC(=C2)C3=CNC4=NC=C(C=C34)C5=CC=CC=C5)C(=O)O |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
SGK1 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | SGK2 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10299-101-1 | Tocris | 2 |
10299-101-2 | MedChem Express | 10479 |
(Kd <100 nM)