LFM-A13/DDE-28 - Small Molecule (ID:10298-101)
HMS LINCS ID: | 10298-101 |
Name: | LFM-A13/DDE-28 |
Alternative Names: | |
LINCS ID: | LSM-6315 |
PubChem CID: | 54686938 |
ChEBI ID: | |
ChEMBL ID: | 228043 |
Molecular Mass: | 357.90 |
InChi: | InChI=1S/C11H8Br2N2O2/c1-6(16)8(5-14)11(17)15-10-4-7(12)2-3-9(10)13/h2-4,16H,1H3,(H,15,17) |
InChi Key: | UVSVTDVJQAJIFG-UHFFFAOYSA-N |
SMILES: | CC(=C(C#N)C(=O)NC1=C(C=CC(=C1)Br)Br)O |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
BTK, GSK3B, PIM1, PIM3 | |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10298-101-1 | Tocris | 1 |
(equivalent to 100 nM ≤ Kd < 1µM)