Shikonin - Small Molecule (ID:10291-101)
HMS LINCS ID: | 10291-101 |
Name: | Shikonin |
Alternative Names: | |
LINCS ID: | LSM-6309 |
PubChem CID: | 479503 |
ChEBI ID: | |
ChEMBL ID: | 9470 |
Molecular Mass: | 288.10 |
InChi: | InChI=1S/C16H16O5/c1-8(2)3-4-10(17)9-7-13(20)14-11(18)5-6-12(19)15(14)16(9)21/h3,5-7,10,17-19H,4H2,1-2H3/t10-/m1/s1 |
InChi Key: | NEZONWMXZKDMKF-SNVBAGLBSA-N |
SMILES: | CC(=CC[C@H](C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)O)C |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
PKM | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MAPT |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10291-101-1 | Enzo Life Sciences |
(equivalent to 100 nM ≤ Kd < 1µM)