BMS-754807 - Small Molecule (ID:10290-101)
HMS LINCS ID: | 10290-101 |
Name: | BMS-754807 |
Alternative Names: | |
LINCS ID: | LSM-6218 |
PubChem CID: | 24785538 |
ChEBI ID: | |
ChEMBL ID: | 575448 |
Molecular Mass: | 461.21 |
InChi: | InChI=1S/C23H24FN9O/c1-23(21(34)26-15-7-8-18(24)25-13-15)9-3-10-32(23)22-28-20(17-4-2-11-33(17)31-22)27-19-12-16(29-30-19)14-5-6-14/h2,4,7-8,11-14H,3,5-6,9-10H2,1H3,(H,26,34)(H2,27,28,29,30,31)/t23-/m0/s1 |
InChi Key: | LQVXSNNAFNGRAH-QHCPKHFHSA-N |
SMILES: | C[C@]1(CCCN1C2=NN3C=CC=C3C(=N2)NC4=NNC(=C4)C5CC5)C(=O)NC6=CN=C(C=C6)F |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
Akt1, Igf1r, IGF1R | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | INSR |
3 (equivalent to 1µM ≤ Kd < 10 µM) | CCNE1, CCNE2, CDK2 |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10290-101-1 | ChemieTek | CT-001 |
(Kd <100 nM)