PD 98059 - Small Molecule (ID:10271-101)
HMS LINCS ID: | 10271-101 |
Name: | PD 98059 |
Alternative Names: | |
LINCS ID: | LSM-3394 |
PubChem CID: | 4713 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 267.09 |
InChi: | InChI=1S/C16H13NO3/c1-19-14-8-4-6-11(16(14)17)15-9-12(18)10-5-2-3-7-13(10)20-15/h2-9H,17H2,1H3 |
InChi Key: | QFWCYNPOPKQOKV-UHFFFAOYSA-N |
SMILES: | COC1=CC=CC(=C1N)C2=CC(=O)C3=CC=CC=C3O2 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
MAP2K1, MAP2K2 | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MAPK1, MT-CO1, PTGS1, RAF1 |
10 (confirmed non-binding) |
Batch Information for HMSL10271-101-1:
HMS LINCS Batch ID: | 10271-101-1 |
Provider: | Sigma-Aldrich |
Provider Batch ID: | |
Salt: | 101 |
Molecular Formula: | C16H13NO3 |
Molecular Weight: | 267.28 |
Purity: | |
Purification Method: | |
Chemical Synthesis Reference: | |
Comments: | |
Date Publicly Available: | 2012-11-14 |
Most Recent Update: | 2016-12-02 |
(equivalent to 100 nM ≤ Kd < 1µM)