Nutlin 3a - Small Molecule (ID:10268-101)
HMS LINCS ID: | 10268-101 |
Name: | Nutlin 3a |
Alternative Names: | |
LINCS ID: | LSM-6351 |
PubChem CID: | 11433190 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 580.16 |
InChi: | InChI=1S/C30H30Cl2N4O4/c1-18(2)40-25-16-23(39-3)12-13-24(25)29-34-27(19-4-8-21(31)9-5-19)28(20-6-10-22(32)11-7-20)36(29)30(38)35-15-14-33-26(37)17-35/h4-13,16,18,27-28H,14-15,17H2,1-3H3,(H,33,37)/t27-,28+/m0/s1 |
InChi Key: | BDUHCSBCVGXTJM-WUFINQPMSA-N |
SMILES: | CC(C)OC1=C(C=CC(=C1)OC)C2=N[C@H]([C@H](N2C(=O)N3CCNC(=O)C3)C4=CC=C(C=C4)Cl)C5=CC=C(C=C5)Cl |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
Mdm2, MDM2, MDM2 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | TP53 |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MDM4 |
Batch Information for HMSL10268-101-1:
HMS LINCS Batch ID: | 10268-101-1 |
Provider: | Roche |
Provider Batch ID: | |
Salt: | 101 |
Molecular Formula: | |
Molecular Weight: | |
Purity: | |
Purification Method: | |
Chemical Synthesis Reference: | |
Comments: | |
Date Publicly Available: | 2012-11-14 |
Most Recent Update: | 2016-12-02 |
(Kd <100 nM)