NSC 663284 - Small Molecule (ID:10266-101)
HMS LINCS ID: | 10266-101 |
Name: | NSC 663284 |
Alternative Names: | |
LINCS ID: | LSM-2042 |
PubChem CID: | 379077 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 321.09 |
InChi: | InChI=1S/C15H16ClN3O3/c16-11-13(18-4-5-19-6-8-22-9-7-19)15(21)12-10(14(11)20)2-1-3-17-12/h1-3,18H,4-9H2 |
InChi Key: | BMKPVDQDJQWBPD-UHFFFAOYSA-N |
SMILES: | C1COCCN1CCNC2=C(C(=O)C3=C(C2=O)N=CC=C3)Cl |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
CDC25A, CDC25B, CDC25C, KMT5A | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | DUSP3 |
10 (confirmed non-binding) |
Batch Information for HMSL10266-101-1:
HMS LINCS Batch ID: | 10266-101-1 |
Provider: | Tocris |
Provider Batch ID: | |
Salt: | 101 |
Molecular Formula: | C15H16ClN3O3 |
Molecular Weight: | 321.76 |
Purity: | |
Purification Method: | |
Chemical Synthesis Reference: | |
Comments: | |
Date Publicly Available: | 2012-11-14 |
Most Recent Update: | 2016-12-02 |
(equivalent to 100 nM ≤ Kd < 1µM)