5-FU - Small Molecule (ID:10238-101)
HMS LINCS ID: | 10238-101 |
Name: | 5-FU |
Alternative Names: | Fluorouracil |
LINCS ID: | LSM-4261 |
PubChem CID: | 3385 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 130.02 |
InChi: | InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
InChi Key: | GHASVSINZRGABV-UHFFFAOYSA-N |
SMILES: | C1=C(C(=O)NC(=O)N1)F |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
TYMS | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MAPT |
10 (confirmed non-binding) |
Batch Information for HMSL10238-101-1:
HMS LINCS Batch ID: | 10238-101-1 |
Provider: | Celgene |
Provider Batch ID: | |
Salt: | 101 |
Molecular Formula: | |
Molecular Weight: | |
Purity: | |
Purification Method: | |
Chemical Synthesis Reference: | |
Comments: | |
Date Publicly Available: | 2012-11-14 |
Most Recent Update: | 2016-12-02 |
(equivalent to 100 nM ≤ Kd < 1µM)