5-DFUR - Small Molecule (ID:10237-101)
HMS LINCS ID: | 10237-101 |
Name: | 5-DFUR |
Alternative Names: | 5-FdUR; Doxifluridine |
LINCS ID: | LSM-6359 |
PubChem CID: | 18343 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 246.07 |
InChi: | InChI=1S/C9H11FN2O5/c1-3-5(13)6(14)8(17-3)12-2-4(10)7(15)11-9(12)16/h2-3,5-6,8,13-14H,1H3,(H,11,15,16)/t3-,5-,6-,8-/m1/s1 |
InChi Key: | ZWAOHEXOSAUJHY-ZIYNGMLESA-N |
SMILES: | C[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=C(C(=O)NC2=O)F)O)O |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
TYMS | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MAPT |
Batch Information for HMSL10237-101-1:
HMS LINCS Batch ID: | 10237-101-1 |
Provider: | Sigma-Aldrich |
Provider Batch ID: | |
Salt: | 101 |
Molecular Formula: | C9H11FN2O5 |
Molecular Weight: | 246.19 |
Purity: | |
Purification Method: | |
Chemical Synthesis Reference: | |
Comments: | |
Date Publicly Available: | 2012-11-14 |
Most Recent Update: | 2016-12-02 |
(equivalent to 100 nM ≤ Kd < 1µM)