PF-3758309 - Small Molecule (ID:10231-101)
HMS LINCS ID: | 10231-101 |
Name: | PF-3758309 |
Alternative Names: | |
LINCS ID: | LSM-4254 |
PubChem CID: | 25227462 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 490.23 |
InChi: | InChI=1S/C25H30N8OS/c1-15-26-18-11-12-35-20(18)23(27-15)29-22-17-13-33(25(2,3)21(17)30-31-22)24(34)28-19(14-32(4)5)16-9-7-6-8-10-16/h6-12,19H,13-14H2,1-5H3,(H,28,34)(H2,26,27,29,30,31)/t19-/m1/s1 |
InChi Key: | AYCPARAPKDAOEN-LJQANCHMSA-N |
SMILES: | CC1=NC2=C(C(=N1)NC3=NNC4=C3CN(C4(C)C)C(=O)N[C@H](CN(C)C)C5=CC=CC=C5)SC=C2 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
PAK1, PAK3, PAK4, PAK5, PAK6 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | PAK2 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
20254 | PF-3758309 KiNativ -- single dose experiment | KiNativ |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10231-101-1 | Haoyuan chemexpress | HM-215B_12-20120808A |
(Kd <100 nM)