KIN001-135 - Small Molecule (ID:10215-101)
HMS LINCS ID: | 10215-101 |
Name: | KIN001-135 |
Alternative Names: | GSK319347A; HMS3229F19; CAY10576; ZINC19795634; AKOS002364333; NCGC00242056-01; benzimidazole-thiophene carbonitrile; EC-000.2375 |
LINCS ID: | LSM-1216 |
PubChem CID: | 11626927 |
ChEBI ID: | |
ChEMBL ID: | 373751 |
Molecular Mass: | 469.08 |
InChi: | InChI=1S/C22H19N3O5S2/c1-28-17-8-15-16(9-18(17)29-2)25(13-24-15)22-10-19(20(11-23)31-22)30-12-14-6-4-5-7-21(14)32(3,26)27/h4-10,13H,12H2,1-3H3 |
InChi Key: | LDTAHRLHGHFHKP-UHFFFAOYSA-N |
SMILES: | COC1=C(C=C2C(=C1)N=CN2C3=CC(=C(S3)C#N)OCC4=CC=CC=C4S(=O)(=O)C)OC |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
IKBKE, TBK1 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | AURKA, AURKB, BRSK2, CHEK2, CLK2, EPHB3, FLT1, GCK, IRAK4, JAK2, MAP3K11, MAP3K9, MAPK15, MINK1, NTRK1, PHKA2, PLK1, PRKAA1, PRKAA2, PRKAB1, PRKAB2, RIPK2, RPS6KA1, STK3, TAOK1 |
3 (equivalent to 1µM ≤ Kd < 10 µM) | AIM1, TGFBR1 |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10215-101-1 | Nathanael Gray (DFCI)/GSK | |
10215-101-2 | EMD Millipore | D00158923 |
(Kd <100 nM)