KIN001-021 - Small Molecule (ID:10212-101)
HMS LINCS ID: | 10212-101 |
Name: | KIN001-021 |
Alternative Names: | CGP082996; CINK4; ZINC01493715 |
LINCS ID: | LSM-1213 |
PubChem CID: | 24825971 |
ChEBI ID: | |
ChEMBL ID: | 1242367 |
Molecular Mass: | 456.26 |
InChi: | InChI=1S/C27H32N6O/c1-2-28-25-17-26(29-21-8-11-23(34)12-9-21)32-27(31-25)30-22-10-13-24-20(16-22)14-15-33(24)18-19-6-4-3-5-7-19/h3-7,10,13-17,21,23,34H,2,8-9,11-12,18H2,1H3,(H3,28,29,30,31,32) |
InChi Key: | YVXCDLCJCIDFHE-UHFFFAOYSA-N |
SMILES: | CCNC1=NC(=NC(=C1)NC2CCC(CC2)O)NC3=CC4=C(C=C3)N(C=C4)CC5=CC=CC=C5 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
CDK4, EPHA3 | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | CCND1, CDK6 |
10 (confirmed non-binding) |
Batch Information for HMSL10212-101-1:
HMS LINCS Batch ID: | 10212-101-1 |
Provider: | Nathanael Gray (DFCI) |
Provider Batch ID: | |
Salt: | 101 |
Molecular Formula: | |
Molecular Weight: | |
Purity: | |
Purification Method: | |
Chemical Synthesis Reference: | |
Comments: | |
Date Publicly Available: | 2011-07-15 |
Most Recent Update: | 2016-12-02 |
(equivalent to 100 nM ≤ Kd < 1µM)