RAF 265 - Small Molecule (ID:10206-101)
| HMS LINCS ID: |
10206-101
|
| Name: | RAF 265 |
| Alternative Names: | CHIR-265 |
| LINCS ID: | LSM-1207 |
| PubChem CID: | 11656518 |
| ChEBI ID: | |
| ChEMBL ID: | |
| Molecular Mass: | 518.13 |
| InChi: | InChI=1S/C24H16F6N6O/c1-36-19-7-6-15(10-17(19)34-22(36)33-14-4-2-13(3-5-14)23(25,26)27)37-16-8-9-31-18(11-16)21-32-12-20(35-21)24(28,29)30/h2-12H,1H3,(H,32,35)(H,33,34) |
| InChi Key: | YABJJWZLRMPFSI-UHFFFAOYSA-N |
| SMILES: | CN1C2=C(C=C(C=C2)OC3=CC(=NC=C3)C4=NC=C(N4)C(F)(F)F)N=C1NC5=CC=C(C=C5)C(F)(F)F |
| Relevant Citations: | |
| Comments: | |
| Date Publicly Available: | |
| Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)| Target Affinity Spectrum Value | HUGO Gene Name |
|---|---|
CIT, DDR1, EIF2AK4, EPHB6, MAP3K19, MAP3K20, STK10 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | BRAF, CSF1R, DDR2, EIF2AK2, FLT1, FRK, HIPK4, KDR, KIT, LCK, LYN, MAP3K7, MAP4K5, PDGFRB, RAF1, RET, RIPK2, SLK, TAOK2, TAOK3, TIE1, TKT, TYK2, YES1 |
3 (equivalent to 1µM ≤ Kd < 10 µM) | ABL1, ABL2, BLK, CDK19, EPHA1, EPHA2, EPHA4, EPHA6, EPHA8, FER, FGFR1, FLG, FLT3, FLT4, FPGT-TNNI3K, FYN, HCK, MAP2K5, MAP3K11, MAP4K2, MAP4K3, MAP4K4, MET, NEK5, PAK3, PDGFRA, PRKAA1, PTK6, RIPK1, SRC, STK25, STK36, SYK, TAOK1, TEK, TNIK, TNK1, TNNI3K |
10 (confirmed non-binding) |
Batch Information for HMSL10206-101-1:
| HMS LINCS Batch ID: | 10206-101-1 |
| Provider: | Haoyuan chemexpress |
| Provider Batch ID: | HY-10248-20111227 |
| Salt: | 101 |
| Molecular Formula: | C24H16F6N6O |
| Molecular Weight: | 518.41 |
| Purity: | |
| Purification Method: | |
| Chemical Synthesis Reference: | |
| Comments: | |
| Date Publicly Available: | 2011-07-15 |
| Most Recent Update: | 2016-04-04 |
HMS QC Testing Events for HMSL10206-101-1:
| Date | HMS QC Outcome | Comment | Files |
|---|---|---|---|
| 04/13/2015 | PASS | HMSL10206-101-1_LCMS.pdf | |
| 04/12/2012 | PASS | None |
(Kd <100 nM)