A66 - Small Molecule (ID:10203-101)
HMS LINCS ID: | 10203-101 |
Name: | A66 |
Alternative Names: | |
LINCS ID: | LSM-1204 |
PubChem CID: | 42636535 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 393.13 |
InChi: | InChI=1S/C17H23N5O2S2/c1-9-12(10-8-25-14(20-10)17(2,3)4)26-15(19-9)21-16(24)22-7-5-6-11(22)13(18)23/h8,11H,5-7H2,1-4H3,(H2,18,23)(H,19,21,24)/t11-/m0/s1 |
InChi Key: | HBPXWEPKNBHKAX-NSHDSACASA-N |
SMILES: | CC1=C(SC(=N1)NC(=O)N2CCC[C@H]2C(=O)N)C3=CSC(=N3)C(C)(C)C |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
PIK3CA | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | PIK3C2B |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MTOR, PIK3C2A, PIK3CB, PIK3CD, PIK3CG |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10203-101-1 | Haoyuan chemexpress | HY-13261-20111104 |
(Kd <100 nM)