NVP-BHG712 - Small Molecule (ID:10200-101)
HMS LINCS ID: | 10200-101 |
Name: | NVP-BHG712 |
Alternative Names: | KIN001-265 |
LINCS ID: | LSM-1201 |
PubChem CID: | 16747388 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 503.17 |
InChi: | InChI=1S/C26H20F3N7O/c1-15-8-9-16(25(37)32-19-7-3-6-18(12-19)26(27,28)29)11-21(15)33-23-20-14-31-36(2)24(20)35-22(34-23)17-5-4-10-30-13-17/h3-14H,1-2H3,(H,32,37)(H,33,34,35) |
InChi Key: | ZCCPLJOKGAACRT-UHFFFAOYSA-N |
SMILES: | CC1=C(C=C(C=C1)C(=O)NC2=CC=CC(=C2)C(F)(F)F)NC3=NC(=NC4=C3C=NN4C)C5=CN=CC=C5 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
EPHB4 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
20104 | NVP-BHG712 KiNativ -- multiple dose experiment | KiNativ |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10200-101-1 | Nathanael Gray (DFCI) | |
10200-101-2 | MedChem Express | 05051 |
(equivalent to 100 nM ≤ Kd < 1µM)