KIN001-260 - Small Molecule (ID:10197-102)
HMS LINCS ID: | 10197-102 |
Name: | KIN001-260 |
Alternative Names: | IKK-2 inhibitor VIII; Bayer IKKb inhibitor |
LINCS ID: | LSM-1198 |
PubChem CID: | 10451420 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 364.19 |
InChi: | InChI=1S/C21H24N4O2/c22-11-16-15(14-6-8-24-9-7-14)10-17(25-21(16)23)20-18(26)2-1-3-19(20)27-12-13-4-5-13/h1-3,10,13-14,24-25H,4-9,12,23H2/b20-17+ |
InChi Key: | DWQVGCQPWXKRKO-LVZFUZTISA-N |
SMILES: | C1CC1COC\2=CC=CC(=O)/C2=C\3/C=C(C(=C(N3)N)C#N)C4CCNCC4 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-08-17 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
IKBKB |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10197-102-1 | Haoyuan chemexpress | HY-13060-20111010 |
(equivalent to 100 nM ≤ Kd < 1µM)