ABT-737 - Small Molecule (ID:10179-999)
HMS LINCS ID: | 10179-999 |
Name: | ABT-737 |
Alternative Names: | |
LINCS ID: | LSM-1180 |
PubChem CID: | 11228183 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 812.26 |
InChi: | InChI=1S/C42H45ClN6O5S2/c1-46(2)23-22-35(30-55-37-9-4-3-5-10-37)44-40-21-20-38(28-41(40)49(51)52)56(53,54)45-42(50)32-14-18-36(19-15-32)48-26-24-47(25-27-48)29-33-8-6-7-11-39(33)31-12-16-34(43)17-13-31/h3-21,28,35,44H,22-27,29-30H2,1-2H3,(H,45,50)/t35-/m1/s1 |
InChi Key: | HPLNQCPCUACXLM-PGUFJCEWSA-N |
SMILES: | CN(C)CC[C@H](CSC1=CC=CC=C1)NC2=C(C=C(C=C2)S(=O)(=O)NC(=O)C3=CC=C(C=C3)N4CCN(CC4)CC5=CC=CC=C5C6=CC=C(C=C6)Cl)[N+](=O)[O-] |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
BAD, BCL2, BCL2L1, BCL2L10, BCL2L2, CSN2 | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | BCL2A1, Mcl1, MCL1 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10179-999-3 |
(Kd <100 nM)