SB 216763 - Small Molecule (ID:10160-101)
HMS LINCS ID: | 10160-101 |
Name: | SB 216763 |
Alternative Names: | |
LINCS ID: | LSM-1161 |
PubChem CID: | 176158 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 370.03 |
InChi: | InChI=1S/C19H12Cl2N2O2/c1-23-9-13(11-4-2-3-5-15(11)23)17-16(18(24)22-19(17)25)12-7-6-10(20)8-14(12)21/h2-9H,1H3,(H,22,24,25) |
InChi Key: | JCSGFHVFHSKIJH-UHFFFAOYSA-N |
SMILES: | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=C(C=C(C=C4)Cl)Cl |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
GSK3A, GSK3B | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | CCNA1, CCNA2, CCNB1, CCNB2, CCNB3, CDK1, CDK2 |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MAPT |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10160-101-1 | Haoyuan chemexpress | HY-12012_1-20110103 |
(Kd <100 nM)