BMS509744 - Small Molecule (ID:10137-101)
HMS LINCS ID: | 10137-101 |
Name: | BMS509744 |
Alternative Names: | BMS-509744 |
LINCS ID: | LSM-1137 |
PubChem CID: | 11467730 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 623.26 |
InChi: | InChI=1S/C32H41N5O4S2/c1-20-16-26(41-7)25(30(40)37-14-12-36(13-15-37)22(3)38)17-27(20)42-28-19-34-31(43-28)35-29(39)24-10-8-23(9-11-24)18-33-21(2)32(4,5)6/h8-11,16-17,19,21,33H,12-15,18H2,1-7H3,(H,34,35,39) |
InChi Key: | ZHXNIYGJAOPMSO-UHFFFAOYSA-N |
SMILES: | CC1=C(C=C(C(=C1)OC)C(=O)N2CCN(CC2)C(=O)C)SC3=CN=C(S3)NC(=O)C4=CC=C(C=C4)CNC(C)C(C)(C)C |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
ITK | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | BTK, FYN, INSR, LCK |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10137-101-1 | Haoyuan chemexpress | HM-090B_TM-20110722 |
(Kd <100 nM)