XMD13-2 - Small Molecule (ID:10088-101)
HMS LINCS ID: | 10088-101 |
Name: | XMD13-2 |
Alternative Names: | |
LINCS ID: | LSM-6296 |
PubChem CID: | |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 360.16 |
InChi: | InChI=1S/C21H20N4O2/c26-20(12-4-5-12)23-19-17-9-6-14(11-18(17)24-25-19)13-2-1-3-15(10-13)21(27)22-16-7-8-16/h1-3,6,9-12,16H,4-5,7-8H2,(H,22,27)(H2,23,24,25,26) |
InChi Key: | WBLZCNIEEVRRTG-UHFFFAOYSA-N |
SMILES: | O=C(C1CC1)NC2=NNC3=CC(C4=CC(C(NC5CC5)=O)=CC=C4)=CC=C32 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
RIPK1 | |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
20072 | XMD13-2 KINOMEscan | KINOMEscan |
KINOMEscan Image
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10088-101-1 | Nathanael Gray (DFCI) | XMD13-2-1 |
(equivalent to 100 nM ≤ Kd < 1µM)