Selumetinib - Small Molecule (ID:10056-999)
| HMS LINCS ID: |
10056-999
|
| Name: | Selumetinib |
| Alternative Names: | AZD6244; Array142886 |
| LINCS ID: | LSM-1056 |
| PubChem CID: | 10127622 |
| ChEBI ID: | |
| ChEMBL ID: | |
| Molecular Mass: | 456.00 |
| InChi: | InChI=1S/C17H15BrClFN4O3/c1-24-8-21-16-13(24)7-10(17(26)23-27-5-4-25)15(14(16)20)22-12-3-2-9(18)6-11(12)19/h2-3,6-8,22,25H,4-5H2,1H3,(H,23,26) |
| InChi Key: | CYOHGALHFOKKQC-UHFFFAOYSA-N |
| SMILES: | CN1C=NC2=C1C=C(C(=C2F)NC3=C(C=C(C=C3)Br)Cl)C(=O)NOCCO |
| Relevant Citations: | |
| Comments: | |
| Date Publicly Available: | |
| Most Recent Update: | 2016-07-12 |
Target Affinity:
(see Study 20000)| Target Affinity Spectrum Value | HUGO Gene Name |
|---|---|
MAP2K1 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | MAP2K2 |
3 (equivalent to 1µM ≤ Kd < 10 µM) | EGFR |
10 (confirmed non-binding) |
Datasets:
| HMS Dataset ID | Dataset Title | HMS Dataset Type |
|---|---|---|
| 20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
| 20156 | AZD-6244 KINOMEscan | KINOMEscan |
| 20266 | Multiplexed imaging of protein levels and protein phosphorylation states in the MCF 10A breast cell line treated with nine kinase inhibitors | Microscopy/Imaging |
| 20267 | Highly-multiplexed imaging by Cyclic Immunofluorescence (CycIF) of protein levels and protein phosphorylation states in the MCF 10A breast cell line treated with EGF or four kinase inhibitors | Microscopy/Imaging |
Batch Information:
| HMS LINCS Batch ID | Provider | Provider Batch ID |
|---|---|---|
| 10056-999-3 | ||
| 10056-999-4 | Selleck Chemicals |
(Kd <100 nM)