Saracatinib - Small Molecule (ID:10032-101)
HMS LINCS ID: | 10032-101 |
Name: | Saracatinib |
Alternative Names: | AZD0530 |
LINCS ID: | LSM-1032 |
PubChem CID: | 10302451 |
ChEBI ID: | |
ChEMBL ID: | 217092 |
Molecular Mass: | 541.21 |
InChi: | InChI=1S/C27H32ClN5O5/c1-32-6-8-33(9-7-32)10-13-35-19-14-21-24(23(15-19)38-18-4-11-34-12-5-18)27(30-16-29-21)31-25-20(28)2-3-22-26(25)37-17-36-22/h2-3,14-16,18H,4-13,17H2,1H3,(H,29,30,31) |
InChi Key: | OUKYUETWWIPKQR-UHFFFAOYSA-N |
SMILES: | CN1CCN(CC1)CCOC2=CC(=C3C(=C2)N=CN=C3NC4=C(C=CC5=C4OCO5)Cl)OC6CCOCC6 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
ABL1, LCK, SRC, YES1 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | CSK, KIT |
3 (equivalent to 1µM ≤ Kd < 10 µM) | EGFR, PDGFRB |
10 (confirmed non-binding) |
Batch Information for HMSL10032-101-2:
HMS LINCS Batch ID: | 10032-101-2 |
Provider: | Haoyuan chemexpress |
Provider Batch ID: | |
Salt: | 101 |
Molecular Formula: | C27H32ClN5O5 |
Molecular Weight: | 542.03 |
Purity: | |
Purification Method: | |
Chemical Synthesis Reference: | |
Comments: | |
Date Publicly Available: | 2011-07-15 |
Most Recent Update: | 2016-12-02 |
(Kd <100 nM)