D 4476 - Small Molecule (ID:10202-101)
HMS LINCS ID: | 10202-101 |
Name: | D 4476 |
Alternative Names: | |
LINCS ID: | LSM-1203 |
PubChem CID: | 6419753 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 398.14 |
InChi: | InChI=1S/C23H18N4O3/c24-22(28)14-4-6-15(7-5-14)23-26-20(21(27-23)17-3-1-2-10-25-17)16-8-9-18-19(13-16)30-12-11-29-18/h1-10,13H,11-12H2,(H2,24,28)(H,26,27) |
InChi Key: | DPDZHVCKYBCJHW-UHFFFAOYSA-N |
SMILES: | C1COC2=C(O1)C=CC(=C2)C3=C(NC(=N3)C4=CC=C(C=C4)C(=O)N)C5=CC=CC=N5 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
cka1, CSNK1A1, Csnk1d, CSNK1D, TGFBR1 | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | MAPK14, PKD1, PRKD1 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10202-101-1 | Tocris |
(equivalent to 100 nM ≤ Kd < 1µM)