KIN001-270 - Small Molecule (ID:10196-101)
HMS LINCS ID: | 10196-101 |
Name: | KIN001-270 |
Alternative Names: | |
LINCS ID: | LSM-1197 |
PubChem CID: | 66577006 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 499.13 |
InChi: | InChI=1S/C26H21N5O4S/c1-16-10-11-18(13-22(16)30-36(2,34)35)29-24-14-23(27-15-28-24)17-6-5-7-19(12-17)31-25(32)20-8-3-4-9-21(20)26(31)33/h3-15,30H,1-2H3,(H,27,28,29) |
InChi Key: | CKUFOBCNTCLXJP-UHFFFAOYSA-N |
SMILES: | CC1=C(C=C(C=C1)NC2=NC=NC(=C2)C3=CC(=CC=C3)N4C(=O)C5=CC=CC=C5C4=O)NS(=O)(=O)C |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
CDK9 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10196-101-1 | Haoyuan chemexpress | HY-13231-20110927 |
(equivalent to 100 nM ≤ Kd < 1µM)