HMN-214 - Small Molecule (ID:10191-101)
HMS LINCS ID: | 10191-101 |
Name: | HMN-214 |
Alternative Names: | |
LINCS ID: | LSM-1192 |
PubChem CID: | 54143018 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 424.11 |
InChi: | InChI=1S/C22H20N2O5S/c1-17(25)24(30(27,28)21-11-9-20(29-2)10-12-21)22-6-4-3-5-19(22)8-7-18-13-15-23(26)16-14-18/h3-16H,1-2H3 |
InChi Key: | OCKHRKSTDPOHEN-UHFFFAOYSA-N |
SMILES: | CC(=O)N(C1=CC=CC=C1C=CC2=CC=[N+](C=C2)[O-])S(=O)(=O)C3=CC=C(C=C3)OC |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
PLK1 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10191-101-1 | Haoyuan chemexpress | HY-12045_1-20101011 |
(equivalent to 100 nM ≤ Kd < 1µM)