MGCD265 analog - Small Molecule (ID:10124-101)
HMS LINCS ID: | 10124-101 |
Name: | MGCD265 analog |
Alternative Names: | |
LINCS ID: | LSM-1124 |
PubChem CID: | 24901704 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 517.10 |
InChi: | InChI=1S/C26H20FN5O2S2/c1-32-14-20(29-15-32)23-13-19-25(36-23)22(9-10-28-19)34-21-8-7-17(12-18(21)27)30-26(35)31-24(33)11-16-5-3-2-4-6-16/h2-10,12-15H,11H2,1H3,(H2,30,31,33,35) |
InChi Key: | UFICVEHDQUKCEA-UHFFFAOYSA-N |
SMILES: | CN1C=C(N=C1)C2=CC3=NC=CC(=C3S2)OC4=C(C=C(C=C4)NC(=S)NC(=O)CC5=CC=CC=C5)F |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2019-03-28 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
KDR, MET | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | FLT1, FLT4, MST1R, TEK |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10124-101-1 | Haoyuan chemexpress | HY-10991-20110922 |
10124-101-2 | MedChem Express | 04651 |
(Kd <100 nM)