HY-50736 - Small Molecule (ID:11947-101)
HMS LINCS ID: | 11947-101 |
Name: | HY-50736 |
Alternative Names: | DUBs-IN-1 |
LINCS ID: | |
PubChem CID: | 16065490 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 337.10 |
InChi: | InChI=1S/C20H11N5O/c21-10-16-17(11-22)24-20-18(23-16)14-8-4-5-9-15(14)19(20)25-26-12-13-6-2-1-3-7-13/h1-9H,12H2/b25-19+ |
InChi Key: | GKOWDIBLCDZJHF-NCELDCMTSA-N |
SMILES: | C1=CC=C(C=C1)CON=C2C3=CC=CC=C3C4=NC(=C(N=C42)C#N)C#N |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2018-08-09 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20350 | Breast Cancer Deubiquitinating Enzyme (DUB) Inhibitor Profiling: Fixed-cell GR measures of 21 breast cell lines to 32 small molecule perturbagens. Dataset 1 of 2: Normalized growth rate inhibition values. | Microscopy/Imaging |
20351 | Breast Cancer Deubiquitinating Enzyme (DUB) Inhibitor Profiling: Fixed-cell GR measures of 21 breast cell lines to 32 small molecule perturbagens. Dataset 2 of 2: Calculated dose response metrics. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
11947-101-1 | MedChem Express |