Baricitinib - Small Molecule (ID:10354-101)
HMS LINCS ID: | 10354-101 |
Name: | Baricitinib |
Alternative Names: | INCB028050; LY3009104 |
LINCS ID: | LSM-6709 |
PubChem CID: | 44205240 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 371.12 |
InChi: | InChI=1S/C16H17N7O2S/c1-2-26(24,25)22-9-16(10-22,4-5-17)23-8-12(7-21-23)14-13-3-6-18-15(13)20-11-19-14/h3,6-8,11H,2,4,9-10H2,1H3,(H,18,19,20) |
InChi Key: | XUZMWHLSFXCVMG-UHFFFAOYSA-N |
SMILES: | CCS(=O)(=O)N1CC(C1)(CC#N)N2C=C(C=N2)C3=C4C=CNC4=NC=N3 |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
JAK1, JAK2, TYK2 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | BMP2K, CAMK2A, JAK3, MAP3K2, PRPF4B, ROCK1, ROCK2 |
10 (confirmed non-binding) |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
20227 | Baricitinib KINOMEscan | KINOMEscan |
20369 | Binding affinity of 6 small molecule JAK inhibitors for 5 kinases | Affinity Data |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10354-101-1 | Selleck Chemicals | S285101 |
(Kd <100 nM)