IPA-3 - Small Molecule (ID:10295-101)
HMS LINCS ID: | 10295-101 |
Name: | IPA-3 |
Alternative Names: | |
LINCS ID: | LSM-6312 |
PubChem CID: | 521106 |
ChEBI ID: | |
ChEMBL ID: | 472940 |
Molecular Mass: | 350.04 |
InChi: | InChI=1S/C20H14O2S2/c21-17-11-9-13-5-1-3-7-15(13)19(17)23-24-20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12,21-22H |
InChi Key: | RFAXLXKIAKIUDT-UHFFFAOYSA-N |
SMILES: | C1=CC=C2C(=C1)C=CC(=C2SSC3=C(C=CC4=CC=CC=C43)O)O |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
PAK1 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10295-101-1 | Sigma-Aldrich | 010M4736 |
10295-101-2 | MedChem Express | 09410 |
(equivalent to 100 nM ≤ Kd < 1µM)