Ro 32-0432 - Small Molecule (ID:10517-102)
| HMS LINCS ID: |
10517-102
|
| Name: | Ro 32-0432 |
| Alternative Names: | RO-320432 |
| LINCS ID: | |
| PubChem CID: | 127757 |
| ChEBI ID: | |
| ChEMBL ID: | |
| Molecular Mass: | 452.22 |
| InChi: | InChI=1S/C28H28N4O2/c1-30(2)15-17-12-13-32-22-11-7-5-9-19(22)24(23(32)14-17)26-25(27(33)29-28(26)34)20-16-31(3)21-10-6-4-8-18(20)21/h4-11,16-17H,12-15H2,1-3H3,(H,29,33,34)/t17-/m0/s1 |
| InChi Key: | FXGHOAZJQNLNFD-KRWDZBQOSA-N |
| SMILES: | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=C5C[C@H](CCN5C6=CC=CC=C64)CN(C)C |
| Relevant Citations: | |
| Comments: | |
| Date Publicly Available: | |
| Most Recent Update: | 2016-05-06 |
Target Affinity:
(see Study 20000)| Target Affinity Spectrum Value | HUGO Gene Name |
|---|---|
GSK3B, PKD1, PRKACA, Prkca, PRKCA, Prkcb, PRKCB, Prkcd, PRKCD, Prkce, PRKCE, Prkcg, PRKCG, Prkch, PRKCH, PRKCI, Prkcq, PRKCQ, Prkcz, PRKCZ, PRKD1, PRKD3 | |
10 (confirmed non-binding) |
Datasets:
| HMS Dataset ID | Dataset Title | HMS Dataset Type |
|---|---|---|
| 20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
| 20268 | Growth rate-corrected (GR) dose-response metrics across a panel of 71 breast cancer cell lines treated with a library of small molecule and antibody perturbagens. Dataset 1 of 4: Relative cell counts and normalized growth rate inhibition values across technical replicates. | Analysis |
| 20269 | Growth rate-corrected (GR) dose-response metrics across a panel of 71 breast cancer cell lines treated with a library of small molecule and antibody perturbagens. Dataset 2 of 4: Calculated dose-response metrics. | Analysis |
Batch Information:
| HMS LINCS Batch ID | Provider | Provider Batch ID |
|---|---|---|
| 10517-102-1 | Tocris |
(Kd <100 nM)