TG003 - Small Molecule (ID:10415-101)
| HMS LINCS ID: |
10415-101
|
| Name: | TG003 |
| Alternative Names: | TG 003; TG-003 |
| LINCS ID: | |
| PubChem CID: | 1893668 |
| ChEBI ID: | |
| ChEMBL ID: | 408982 |
| Molecular Mass: | 249.08 |
| InChi: | InChI=1S/C13H15NO2S/c1-4-14-11-8-10(16-3)5-6-12(11)17-13(14)7-9(2)15/h5-8H,4H2,1-3H3 |
| InChi Key: | BGVLELSCIHASRV-UHFFFAOYSA-N |
| SMILES: | CCN1C2=C(C=CC(=C2)OC)SC1=CC(=O)C |
| Relevant Citations: | |
| Comments: | |
| Date Publicly Available: | |
| Most Recent Update: | 2017-05-09 |
Target Affinity:
(see Study 20000)| Target Affinity Spectrum Value | HUGO Gene Name |
|---|---|
Clk1, CLK1, CLK2, Clk4, CLK4 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | Clk2, CSNK1D, CSNK1E, CSNK1G2, CSNK1G3, Dyrk1a, DYRK1A, DYRK1B, MAP3K19, PIM1, PIM3 |
3 (equivalent to 1µM ≤ Kd < 10 µM) | CLK3 |
10 (confirmed non-binding) |
Batch Information for HMSL10415-101-1:
| HMS LINCS Batch ID: | 10415-101-1 |
| Provider: | MedChem Express |
| Provider Batch ID: | 10834 |
| Salt: | 101 |
| Molecular Formula: | C13H15NO2S |
| Molecular Weight: | 249.33 |
| Purity: | |
| Purification Method: | |
| Chemical Synthesis Reference: | |
| Comments: | |
| Date Publicly Available: | 2015-08-27 |
| Most Recent Update: | 2016-04-04 |
HMS QC Testing Events for HMSL10415-101-1:
| Date | HMS QC Outcome | Comment | Files |
|---|---|---|---|
| 08/31/2015 | PASS | HMSL10415-101-1_LCMS.pdf |
(Kd <100 nM)