ABT-751 - Small Molecule (ID:10352-101)
HMS LINCS ID: | 10352-101 |
Name: | ABT-751 |
Alternative Names: | E7010 |
LINCS ID: | LSM-6285 |
PubChem CID: | 3035714 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 371.09 |
InChi: | InChI=1S/C18H17N3O4S/c1-25-15-8-10-16(11-9-15)26(23,24)21-17-3-2-12-19-18(17)20-13-4-6-14(22)7-5-13/h2-12,21-22H,1H3,(H,19,20) |
InChi Key: | URCVCIZFVQDVPM-UHFFFAOYSA-N |
SMILES: | COC1=CC=C(C=C1)S(=O)(=O)NC2=C(N=CC=C2)NC3=CC=C(C=C3)O |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
TUBB | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | TUBA1A, TUBA1B, TUBA1C, TUBA3D, TUBA3E, TUBA4A, TUBB1, TUBB2A, TUBB2B, TUBB3, TUBB4A, TUBB4B, TUBB6, TUBB8 |
Datasets:
HMS Dataset ID | Dataset Title | HMS Dataset Type |
---|---|---|
20000 | Target Affinity Spectrum (TAS) vectors for compounds in the HMS LINCS small molecule library. | Analysis |
Batch Information:
HMS LINCS Batch ID | Provider | Provider Batch ID |
---|---|---|
10352-101-1 | Selleck Chemicals | S116501 |
(equivalent to 100 nM ≤ Kd < 1µM)