(Z)-4-Hydroxytamoxifen - Small Molecule (ID:10275-101)
HMS LINCS ID: | 10275-101 |
Name: | (Z)-4-Hydroxytamoxifen |
Alternative Names: | |
LINCS ID: | LSM-43294 |
PubChem CID: | 53770298 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 387.22 |
InChi: | InChI=1S/C26H29NO2/c1-4-25(20-10-14-23(28)15-11-20)26(21-8-6-5-7-9-21)22-12-16-24(17-13-22)29-19-18-27(2)3/h5-17,28H,4,18-19H2,1-3H3 |
InChi Key: | DODQJNMQWMSYGS-UHFFFAOYSA-N |
SMILES: | CCC(=C(C1=CC=CC=C1)C2=CC=C(C=C2)OCCN(C)C)C3=CC=C(C=C3)O |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2018-03-30 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
Esr1, ESR1, Esr2, ESR2 | |
2 (equivalent to 100 nM ≤ Kd < 1µM) | ESRRG |
3 (equivalent to 1µM ≤ Kd < 10 µM) | Ar |
10 (confirmed non-binding) |
Batch Information for HMSL10275-101-1:
HMS LINCS Batch ID: | 10275-101-1 |
Provider: | Sigma-Aldrich |
Provider Batch ID: | |
Salt: | 101 |
Molecular Formula: | C26H29NO2 |
Molecular Weight: | 387.51 |
Purity: | |
Purification Method: | |
Chemical Synthesis Reference: | |
Comments: | |
Date Publicly Available: | 2012-11-14 |
Most Recent Update: | 2016-12-02 |
(Kd <100 nM)