Fascaplysin - Small Molecule (ID:10251-112)
HMS LINCS ID: | 10251-112 |
Name: | Fascaplysin |
Alternative Names: | |
LINCS ID: | LSM-4272 |
PubChem CID: | 73293 |
ChEBI ID: | |
ChEMBL ID: | |
Molecular Mass: | 271.09 |
InChi: | InChI=1S/C18H10N2O/c21-18-13-6-2-4-8-15(13)20-10-9-12-11-5-1-3-7-14(11)19-16(12)17(18)20/h1-10H/p+1 |
InChi Key: | WYQIPCUPNMRAKP-UHFFFAOYSA-O |
SMILES: | C1=CC=C2C(=C1)C3=C(N2)C4=[N+](C=C3)C5=CC=CC=C5C4=O |
Relevant Citations: | |
Comments: | |
Date Publicly Available: | |
Most Recent Update: | 2016-04-04 |
Target Affinity:
(see Study 20000)Target Affinity Spectrum Value | HUGO Gene Name |
---|---|
CDK4 | |
3 (equivalent to 1µM ≤ Kd < 10 µM) | CCND1 |
10 (confirmed non-binding) |
Batch Information for HMSL10251-112-1:
HMS LINCS Batch ID: | 10251-112-1 |
Provider: | Sigma-Aldrich |
Provider Batch ID: | |
Salt: | 112 |
Molecular Formula: | C18H11ClN2O.xH2O |
Molecular Weight: | |
Purity: | |
Purification Method: | |
Chemical Synthesis Reference: | |
Comments: | |
Date Publicly Available: | 2012-11-14 |
Most Recent Update: | 2016-12-02 |
(equivalent to 100 nM ≤ Kd < 1µM)